C10H11ClN2O — CID 82234591
7-chloro-5-methyl-3-(methylamino)-1,3-dihydroindol-2-one (PubChem CID 82234591) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is 7-chloro-5-methyl-3-(methylamino)-1,3-dihydroindol-2-one.
| Compound Name | 7-chloro-5-methyl-3-(methylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82234591 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 7-chloro-5-methyl-3-(methylamino)-1,3-dihydroindol-2-one |
| SMILES | CNC1C(=O)Nc2c(Cl)cc(C)cc21 |
| InChI | InChI=1S/C10H11ClN2O/c1-5-3-6-8(7(11)4-5)13-10(14)9(6)12-2/h3-4,9,12H,1-2H3,(H,13,14) |
| InChIKey | QOHYIYYCVNSPNF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |