C9H8ClFN2O — CID 82234607
4-chloro-7-fluoro-3-(methylamino)-1,3-dihydroindol-2-one (PubChem CID 82234607) has the molecular formula C9H8ClFN2O and a molecular weight of 214.63 g/mol. Its IUPAC name is 4-chloro-7-fluoro-3-(methylamino)-1,3-dihydroindol-2-one.
| Compound Name | 4-chloro-7-fluoro-3-(methylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82234607 |
| Molecular Formula | C9H8ClFN2O |
| Molecular Weight | 214.63 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 4-chloro-7-fluoro-3-(methylamino)-1,3-dihydroindol-2-one |
| SMILES | CNC1C(=O)Nc2c(F)ccc(Cl)c21 |
| InChI | InChI=1S/C9H8ClFN2O/c1-12-8-6-4(10)2-3-5(11)7(6)13-9(8)14/h2-3,8,12H,1H3,(H,13,14) |
| InChIKey | YNORRHDUWZTGDB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.63 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |