C11H11ClN2O — CID 82239753
7-chloro-3-(cyclopropylamino)-1,3-dihydroindol-2-one (PubChem CID 82239753) has the molecular formula C11H11ClN2O and a molecular weight of 222.68 g/mol. Its IUPAC name is 7-chloro-3-(cyclopropylamino)-1,3-dihydroindol-2-one.
| Compound Name | 7-chloro-3-(cyclopropylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82239753 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 7-chloro-3-(cyclopropylamino)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2c(Cl)cccc2C1NC1CC1 |
| InChI | InChI=1S/C11H11ClN2O/c12-8-3-1-2-7-9(8)14-11(15)10(7)13-6-4-5-6/h1-3,6,10,13H,4-5H2,(H,14,15) |
| InChIKey | SLRSXASLBRGEEZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |