C11H14N2O2 — CID 84620706
3-ethyl-5-methoxy-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 84620706) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-ethyl-5-methoxy-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 3-ethyl-5-methoxy-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 84620706 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-ethyl-5-methoxy-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | CCC1Nc2c(cccc2OC)NC1=O |
| InChI | InChI=1S/C11H14N2O2/c1-3-7-11(14)13-8-5-4-6-9(15-2)10(8)12-7/h4-7,12H,3H2,1-2H3,(H,13,14) |
| InChIKey | NISKSCCEJUBPHE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |