C10H12N2O2 — CID 82075718
3-(aminomethyl)-7-methoxy-1,3-dihydroindol-2-one (PubChem CID 82075718) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3-(aminomethyl)-7-methoxy-1,3-dihydroindol-2-one.
| Compound Name | 3-(aminomethyl)-7-methoxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82075718 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3-(aminomethyl)-7-methoxy-1,3-dihydroindol-2-one |
| SMILES | COc1cccc2c1NC(=O)C2CN |
| InChI | InChI=1S/C10H12N2O2/c1-14-8-4-2-3-6-7(5-11)10(13)12-9(6)8/h2-4,7H,5,11H2,1H3,(H,12,13) |
| InChIKey | WCYIPBLOAZINQE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |