C11H14N2O2 — CID 84620678
8-methoxy-4-(methylamino)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 84620678) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 8-methoxy-4-(methylamino)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-methoxy-4-(methylamino)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 84620678 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 8-methoxy-4-(methylamino)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CNC1CC(=O)Nc2c(OC)cccc21 |
| InChI | InChI=1S/C11H14N2O2/c1-12-8-6-10(14)13-11-7(8)4-3-5-9(11)15-2/h3-5,8,12H,6H2,1-2H3,(H,13,14) |
| InChIKey | DGHIFUGGSHRRRK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |