C10H11BrN2O — CID 84635515
8-bromo-4-(methylamino)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 84635515) has the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. Its IUPAC name is 8-bromo-4-(methylamino)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-bromo-4-(methylamino)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 84635515 |
| Molecular Formula | C10H11BrN2O |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 8-bromo-4-(methylamino)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CNC1CC(=O)Nc2c(Br)cccc21 |
| InChI | InChI=1S/C10H11BrN2O/c1-12-8-5-9(14)13-10-6(8)3-2-4-7(10)11/h2-4,8,12H,5H2,1H3,(H,13,14) |
| InChIKey | JHAAFODEBPMLFJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |