C10H13BrN2 — CID 83758541
7-bromo-N,1-dimethyl-2,3-dihydroindol-3-amine (PubChem CID 83758541) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is 7-bromo-N,1-dimethyl-2,3-dihydroindol-3-amine.
| Compound Name | 7-bromo-N,1-dimethyl-2,3-dihydroindol-3-amine |
|---|---|
| PubChem CID | 83758541 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 7-bromo-N,1-dimethyl-2,3-dihydroindol-3-amine |
| SMILES | CNC1CN(C)c2c(Br)cccc21 |
| InChI | InChI=1S/C10H13BrN2/c1-12-9-6-13(2)10-7(9)4-3-5-8(10)11/h3-5,9,12H,6H2,1-2H3 |
| InChIKey | XCOLXLYWKSFIKA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |