C11H14BrNS — CID 43539442
8-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43539442) has the molecular formula C11H14BrNS and a molecular weight of 272.21 g/mol. Its IUPAC name is 8-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | 8-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 43539442 |
| Molecular Formula | C11H14BrNS |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 8-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCNC1CCSc2c(Br)cccc21 |
| InChI | InChI=1S/C11H14BrNS/c1-2-13-10-6-7-14-11-8(10)4-3-5-9(11)12/h3-5,10,13H,2,6-7H2,1H3 |
| InChIKey | SOZWIZKRUGBGTB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |