C11H13BrClN — CID 165498852
5-bromo-4-chloro-3,3,7-trimethyl-1,2-dihydroindole (PubChem CID 165498852) has the molecular formula C11H13BrClN and a molecular weight of 274.59 g/mol. Its IUPAC name is 5-bromo-4-chloro-3,3,7-trimethyl-1,2-dihydroindole.
| Compound Name | 5-bromo-4-chloro-3,3,7-trimethyl-1,2-dihydroindole |
|---|---|
| PubChem CID | 165498852 |
| Molecular Formula | C11H13BrClN |
| Molecular Weight | 274.59 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 5-bromo-4-chloro-3,3,7-trimethyl-1,2-dihydroindole |
| SMILES | Cc1cc(Br)c(Cl)c2c1NCC2(C)C |
| InChI | InChI=1S/C11H13BrClN/c1-6-4-7(12)9(13)8-10(6)14-5-11(8,2)3/h4,14H,5H2,1-3H3 |
| InChIKey | ZUEFGFMCEHUXBY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |