C22H36Si2 — CID 10981171
trimethyl-[3-propan-2-ylidene-7-tri(propan-2-yl)silylhepta-1,4,6-triynyl]silane (PubChem CID 10981171) has the molecular formula C22H36Si2 and a molecular weight of 356.70 g/mol. Its IUPAC name is trimethyl-[3-propan-2-ylidene-7-tri(propan-2-yl)silylhepta-1,4,6-triynyl]silane.
| Compound Name | trimethyl-[3-propan-2-ylidene-7-tri(propan-2-yl)silylhepta-1,4,6-triynyl]silane |
|---|---|
| PubChem CID | 10981171 |
| Molecular Formula | C22H36Si2 |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | trimethyl-[3-propan-2-ylidene-7-tri(propan-2-yl)silylhepta-1,4,6-triynyl]silane |
| SMILES | CC(C)=C(C#CC#C[Si](C(C)C)(C(C)C)C(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C22H36Si2/c1-18(2)22(15-17-23(9,10)11)14-12-13-16-24(19(3)4,20(5)6)21(7)8/h19-21H,1-11H3 |
| InChIKey | HXVAIVVTPMEWRC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|