C21H23N5O2 — CID 10981716
4-N-cyclohexyl-1-(4-nitrophenyl)-3-phenylpyrazole-4,5-diamine (PubChem CID 10981716) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-N-cyclohexyl-1-(4-nitrophenyl)-3-phenylpyrazole-4,5-diamine.
| Compound Name | 4-N-cyclohexyl-1-(4-nitrophenyl)-3-phenylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 10981716 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 4-N-cyclohexyl-1-(4-nitrophenyl)-3-phenylpyrazole-4,5-diamine |
| SMILES | Nc1c(NC2CCCCC2)c(-c2ccccc2)nn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H23N5O2/c22-21-20(23-16-9-5-2-6-10-16)19(15-7-3-1-4-8-15)24-25(21)17-11-13-18(14-12-17)26(27)28/h1,3-4,7-8,11-14,16,23H,2,5-6,9-10,22H2 |
| InChIKey | FJOWSRBKNZNISS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|