C24H19NO4 — CID 10981904
[(1S,2S)-2-(1,3-dioxoisoindol-2-yl)-1-phenylpropyl] benzoate (PubChem CID 10981904) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is [(1S,2S)-2-(1,3-dioxoisoindol-2-yl)-1-phenylpropyl] benzoate.
| Compound Name | [(1S,2S)-2-(1,3-dioxoisoindol-2-yl)-1-phenylpropyl] benzoate |
|---|---|
| PubChem CID | 10981904 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [(1S,2S)-2-(1,3-dioxoisoindol-2-yl)-1-phenylpropyl] benzoate |
| SMILES | C[C@@H]([C@@H](OC(=O)c1ccccc1)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H19NO4/c1-16(25-22(26)19-14-8-9-15-20(19)23(25)27)21(17-10-4-2-5-11-17)29-24(28)18-12-6-3-7-13-18/h2-16,21H,1H3/t16-,21+/m0/s1 |
| InChIKey | DIBICCHJUGIKCS-HRAATJIYSA-N |
| XLogP | 4.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|