C24H19N3O3 — CID 10982189
17-oxa-4,14,20-triazahexacyclo[18.6.1.17,14.02,6.08,13.021,26]octacosa-1(27),2(6),7(28),8,10,12,21,23,25-nonaene-3,5-dione (PubChem CID 10982189) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 17-oxa-4,14,20-triazahexacyclo[18.6.1.17,14.02,6.08,13.021,26]octacosa-1(27),2(6),7(28),8,10,12,21,23,25-nonaene-3,5-dione.
| Compound Name | 17-oxa-4,14,20-triazahexacyclo[18.6.1.17,14.02,6.08,13.021,26]octacosa-1(27),2(6),7(28),8,10,12,21,23,25-nonaene-3,5-dione |
|---|---|
| PubChem CID | 10982189 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 17-oxa-4,14,20-triazahexacyclo[18.6.1.17,14.02,6.08,13.021,26]octacosa-1(27),2(6),7(28),8,10,12,21,23,25-nonaene-3,5-dione |
| SMILES | O=C1NC(=O)C2=C1c1cn(c3ccccc13)CCOCCn1cc2c2ccccc21 |
| InChI | InChI=1S/C24H19N3O3/c28-23-21-17-13-26(19-7-3-1-5-15(17)19)9-11-30-12-10-27-14-18(22(21)24(29)25-23)16-6-2-4-8-20(16)27/h1-8,13-14H,9-12H2,(H,25,28,29) |
| InChIKey | JQCFJDGLRIUQID-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|