C13H12Cl2FN3O5S — CID 10982513
N-[5-[(6R,7aR)-6-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-4-fluorophenyl]-1-chloromethanesulfonamide (PubChem CID 10982513) has the molecular formula C13H12Cl2FN3O5S and a molecular weight of 412.23 g/mol. Its IUPAC name is N-[5-[(6R,7aR)-6-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-4-fluorophenyl]-1-chloromethanesulfonamide.
| Compound Name | N-[5-[(6R,7aR)-6-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-4-fluorophenyl]-1-chloromethanesulfonamide |
|---|---|
| PubChem CID | 10982513 |
| Molecular Formula | C13H12Cl2FN3O5S |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | N-[5-[(6R,7aR)-6-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-4-fluorophenyl]-1-chloromethanesulfonamide |
| SMILES | O=C1[C@H]2C[C@@H](O)CN2C(=O)N1c1cc(NS(=O)(=O)CCl)c(Cl)cc1F |
| InChI | InChI=1S/C13H12Cl2FN3O5S/c14-5-25(23,24)17-9-3-10(8(16)2-7(9)15)19-12(21)11-1-6(20)4-18(11)13(19)22/h2-3,6,11,17,20H,1,4-5H2/t6-,11-/m1/s1 |
| InChIKey | WRYNMXMIXJDOSS-KSBSHMNSSA-N |
| XLogP | 1.32 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|