C22H18ClF3N2O2 — CID 10982954
6-chloro-4-(2-cyclopropylethynyl)-1-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)-3H-quinazolin-2-one (PubChem CID 10982954) has the molecular formula C22H18ClF3N2O2 and a molecular weight of 434.85 g/mol. Its IUPAC name is 6-chloro-4-(2-cyclopropylethynyl)-1-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)-3H-quinazolin-2-one.
| Compound Name | 6-chloro-4-(2-cyclopropylethynyl)-1-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)-3H-quinazolin-2-one |
|---|---|
| PubChem CID | 10982954 |
| Molecular Formula | C22H18ClF3N2O2 |
| Molecular Weight | 434.85 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 6-chloro-4-(2-cyclopropylethynyl)-1-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)-3H-quinazolin-2-one |
| SMILES | COc1ccc(CN2C(=O)NC(C#CC3CC3)(C(F)(F)F)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C22H18ClF3N2O2/c1-30-17-7-4-15(5-8-17)13-28-19-9-6-16(23)12-18(19)21(22(24,25)26,27-20(28)29)11-10-14-2-3-14/h4-9,12,14H,2-3,13H2,1H3,(H,27,29) |
| InChIKey | NGVBCXMCKVUQSZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.85 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|