C25H21ClN4O2 — CID 10343451
6-chloro-4-cyclopropyl-1-[(4-methoxyphenyl)methyl]-4-(2-pyrazin-2-ylethynyl)-3H-quinazolin-2-one (PubChem CID 10343451) has the molecular formula C25H21ClN4O2 and a molecular weight of 444.92 g/mol. Its IUPAC name is 6-chloro-4-cyclopropyl-1-[(4-methoxyphenyl)methyl]-4-(2-pyrazin-2-ylethynyl)-3H-quinazolin-2-one.
| Compound Name | 6-chloro-4-cyclopropyl-1-[(4-methoxyphenyl)methyl]-4-(2-pyrazin-2-ylethynyl)-3H-quinazolin-2-one |
|---|---|
| PubChem CID | 10343451 |
| Molecular Formula | C25H21ClN4O2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 6-chloro-4-cyclopropyl-1-[(4-methoxyphenyl)methyl]-4-(2-pyrazin-2-ylethynyl)-3H-quinazolin-2-one |
| SMILES | COc1ccc(CN2C(=O)NC(C#Cc3cnccn3)(C3CC3)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C25H21ClN4O2/c1-32-21-7-2-17(3-8-21)16-30-23-9-6-19(26)14-22(23)25(18-4-5-18,29-24(30)31)11-10-20-15-27-12-13-28-20/h2-3,6-9,12-15,18H,4-5,16H2,1H3,(H,29,31) |
| InChIKey | AHSUUABWMHQQCC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|