C24H18ClF5N2O2 — CID 132570835
(4R)-6-chloro-1-[(4-methoxyphenyl)methyl]-4-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-3H-quinazolin-2-one (PubChem CID 132570835) has the molecular formula C24H18ClF5N2O2 and a molecular weight of 496.86 g/mol. Its IUPAC name is (4R)-6-chloro-1-[(4-methoxyphenyl)methyl]-4-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-3H-quinazolin-2-one.
| Compound Name | (4R)-6-chloro-1-[(4-methoxyphenyl)methyl]-4-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-3H-quinazolin-2-one |
|---|---|
| PubChem CID | 132570835 |
| Molecular Formula | C24H18ClF5N2O2 |
| Molecular Weight | 496.86 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | (4R)-6-chloro-1-[(4-methoxyphenyl)methyl]-4-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-3H-quinazolin-2-one |
| SMILES | COc1ccc(CN2C(=O)N[C@@](c3ccccc3)(C(F)(F)C(F)(F)F)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C24H18ClF5N2O2/c1-34-18-10-7-15(8-11-18)14-32-20-12-9-17(25)13-19(20)22(31-21(32)33,16-5-3-2-4-6-16)23(26,27)24(28,29)30/h2-13H,14H2,1H3,(H,31,33)/t22-/m1/s1 |
| InChIKey | ONDDRDHAFUOSTE-JOCHJYFZSA-N |
| XLogP | 6.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.86 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|