C25H18Cl3N3O — CID 10050954
(4S)-6-chloro-4-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]-4-(2-pyridin-2-ylethynyl)-3H-quinazolin-2-one (PubChem CID 10050954) has the molecular formula C25H18Cl3N3O and a molecular weight of 482.80 g/mol. Its IUPAC name is (4S)-6-chloro-4-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]-4-(2-pyridin-2-ylethynyl)-3H-quinazolin-2-one.
| Compound Name | (4S)-6-chloro-4-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]-4-(2-pyridin-2-ylethynyl)-3H-quinazolin-2-one |
|---|---|
| PubChem CID | 10050954 |
| Molecular Formula | C25H18Cl3N3O |
| Molecular Weight | 482.80 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | (4S)-6-chloro-4-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]-4-(2-pyridin-2-ylethynyl)-3H-quinazolin-2-one |
| SMILES | O=C1N[C@](C#Cc2ccccn2)(C2CC2)c2cc(Cl)ccc2N1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H18Cl3N3O/c26-17-9-10-23-20(14-17)25(16-7-8-16,12-11-18-4-1-2-13-29-18)30-24(32)31(23)15-19-21(27)5-3-6-22(19)28/h1-6,9-10,13-14,16H,7-8,15H2,(H,30,32)/t25-/m1/s1 |
| InChIKey | VSKDHECLNCAMRZ-RUZDIDTESA-N |
| XLogP | 6.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.80 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|