C22H30O4Se — CID 10982991
(1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-3-phenylselanyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one (PubChem CID 10982991) has the molecular formula C22H30O4Se and a molecular weight of 437.44 g/mol. Its IUPAC name is (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-3-phenylselanyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one.
| Compound Name | (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-3-phenylselanyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
|---|---|
| PubChem CID | 10982991 |
| Molecular Formula | C22H30O4Se |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-3-phenylselanyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H](O)[C@H]([Se]c2ccccc2)CC(=O)O1 |
| InChI | InChI=1S/C22H30O4Se/c1-15-8-4-2-5-9-16-12-17(23)13-19(16)22(25)20(14-21(24)26-15)27-18-10-6-3-7-11-18/h3,5-7,9-11,15-17,19-20,22-23,25H,2,4,8,12-14H2,1H3/b9-5+/t15-,16+,17-,19+,20+,22-/m0/s1 |
| InChIKey | LPADNYFBEMZNNM-LJJFVIJXSA-N |
| XLogP | 2.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|