C27H25N3O5 — CID 10983568
methyl 2-[3-(6-nitro-2-phenyl-1H-indol-3-yl)propanoylamino]-3-phenylpropanoate (PubChem CID 10983568) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is methyl 2-[3-(6-nitro-2-phenyl-1H-indol-3-yl)propanoylamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[3-(6-nitro-2-phenyl-1H-indol-3-yl)propanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10983568 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | methyl 2-[3-(6-nitro-2-phenyl-1H-indol-3-yl)propanoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)CCc1c(-c2ccccc2)[nH]c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C27H25N3O5/c1-35-27(32)24(16-18-8-4-2-5-9-18)28-25(31)15-14-22-21-13-12-20(30(33)34)17-23(21)29-26(22)19-10-6-3-7-11-19/h2-13,17,24,29H,14-16H2,1H3,(H,28,31) |
| InChIKey | BUNNUXALBNLQGS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|