C35H66O5Si2 — CID 10985015
prop-2-enyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 10985015) has the molecular formula C35H66O5Si2 and a molecular weight of 623.08 g/mol. Its IUPAC name is prop-2-enyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | prop-2-enyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 10985015 |
| Molecular Formula | C35H66O5Si2 |
| Molecular Weight | 623.08 g/mol |
| Exact Mass | 622.44 |
| IUPAC Name | prop-2-enyl 7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | C=CCOC(=O)CCCCCC[C@@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H66O5Si2/c1-13-15-18-21-28(39-41(9,10)34(3,4)5)24-25-30-29(22-19-16-17-20-23-33(37)38-26-14-2)31(36)27-32(30)40-42(11,12)35(6,7)8/h14,24-25,28-30,32H,2,13,15-23,26-27H2,1,3-12H3/b25-24+/t28-,29-,30+,32+/m0/s1 |
| InChIKey | GRDVVNCSJOOAPZ-VHXYRUGLSA-N |
| XLogP | 10.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.08 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|