C10H16O2S — CID 10987274
(1S,2R)-3-(propylsulfanylmethyl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 10987274) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is (1S,2R)-3-(propylsulfanylmethyl)cyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2R)-3-(propylsulfanylmethyl)cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 10987274 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | (1S,2R)-3-(propylsulfanylmethyl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | CCCSCC1=CC=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H16O2S/c1-2-6-13-7-8-4-3-5-9(11)10(8)12/h3-5,9-12H,2,6-7H2,1H3/t9-,10+/m0/s1 |
| InChIKey | JAWJFZZXUIIQBC-VHSXEESVSA-N |
| XLogP | 1.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|