C15H25NO2 — CID 10988744
6-but-3-enyl-4,4-dimethyl-6-(2-methylpropyl)piperidine-2,5-dione (PubChem CID 10988744) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 6-but-3-enyl-4,4-dimethyl-6-(2-methylpropyl)piperidine-2,5-dione.
| Compound Name | 6-but-3-enyl-4,4-dimethyl-6-(2-methylpropyl)piperidine-2,5-dione |
|---|---|
| PubChem CID | 10988744 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 6-but-3-enyl-4,4-dimethyl-6-(2-methylpropyl)piperidine-2,5-dione |
| SMILES | C=CCCC1(CC(C)C)NC(=O)CC(C)(C)C1=O |
| InChI | InChI=1S/C15H25NO2/c1-6-7-8-15(9-11(2)3)13(18)14(4,5)10-12(17)16-15/h6,11H,1,7-10H2,2-5H3,(H,16,17) |
| InChIKey | PIVHIWYRMWJBFR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|