C13H20N2NaO3+ — CID 54606407
sodium 5-but-3-enyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione (PubChem CID 54606407) has the molecular formula C13H20N2NaO3+ and a molecular weight of 275.30 g/mol. Its IUPAC name is sodium 5-but-3-enyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | sodium 5-but-3-enyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 54606407 |
| Molecular Formula | C13H20N2NaO3+ |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | sodium 5-but-3-enyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCCC1(CCC(C)C)C(=O)NC(=O)NC1=O.[Na+] |
| InChI | InChI=1S/C13H20N2O3.Na/c1-4-5-7-13(8-6-9(2)3)10(16)14-12(18)15-11(13)17;/h4,9H,1,5-8H2,2-3H3,(H2,14,15,16,17,18);/q;+1 |
| InChIKey | QLZIFZFEDAZYFG-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|