C11H19FN2O3 — CID 70470534
5-ethyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione;hydrofluoride (PubChem CID 70470534) has the molecular formula C11H19FN2O3 and a molecular weight of 246.28 g/mol. Its IUPAC name is 5-ethyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione;hydrofluoride.
| Compound Name | 5-ethyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione;hydrofluoride |
|---|---|
| PubChem CID | 70470534 |
| Molecular Formula | C11H19FN2O3 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 5-ethyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione;hydrofluoride |
| SMILES | CCC1(CCC(C)C)C(=O)NC(=O)NC1=O.F |
| InChI | InChI=1S/C11H18N2O3.FH/c1-4-11(6-5-7(2)3)8(14)12-10(16)13-9(11)15;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);1H |
| InChIKey | ZHWIHOMSDWPFIA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|