C8H13ClN2O3 — CID 22163315
5,5-diethyl-1,3-diazinane-2,4,6-trione;hydrochloride (PubChem CID 22163315) has the molecular formula C8H13ClN2O3 and a molecular weight of 220.66 g/mol. Its IUPAC name is 5,5-diethyl-1,3-diazinane-2,4,6-trione;hydrochloride.
| Compound Name | 5,5-diethyl-1,3-diazinane-2,4,6-trione;hydrochloride |
|---|---|
| PubChem CID | 22163315 |
| Molecular Formula | C8H13ClN2O3 |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 5,5-diethyl-1,3-diazinane-2,4,6-trione;hydrochloride |
| SMILES | CCC1(CC)C(=O)NC(=O)NC1=O.Cl |
| InChI | InChI=1S/C8H12N2O3.ClH/c1-3-8(4-2)5(11)9-7(13)10-6(8)12;/h3-4H2,1-2H3,(H2,9,10,11,12,13);1H |
| InChIKey | SACKVYGWWZDWQS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|