C15H26N2O3 — CID 3050733
5-ethyl-5-(2-ethyl-5-methylhexyl)-1,3-diazinane-2,4,6-trione (PubChem CID 3050733) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 5-ethyl-5-(2-ethyl-5-methylhexyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethyl-5-(2-ethyl-5-methylhexyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3050733 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 5-ethyl-5-(2-ethyl-5-methylhexyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCC(CCC(C)C)CC1(CC)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C15H26N2O3/c1-5-11(8-7-10(3)4)9-15(6-2)12(18)16-14(20)17-13(15)19/h10-11H,5-9H2,1-4H3,(H2,16,17,18,19,20) |
| InChIKey | FTTYRSOJRKTVTR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|