C11H16N2O4 — CID 24189
Barbituric acid, 5-allyl-5-(2-methoxypropyl)- (PubChem CID 24189) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5-(2-methoxypropyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | Barbituric acid, 5-allyl-5-(2-methoxypropyl)- |
|---|---|
| PubChem CID | 24189 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 5-(2-methoxypropyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(CC1(C(=O)NC(=O)NC1=O)CC=C)OC |
| InChI | InChI=1S/C11H16N2O4/c1-4-5-11(6-7(2)17-3)8(14)12-10(16)13-9(11)15/h4,7H,1,5-6H2,2-3H3,(H2,12,13,14,15,16) |
| InChIKey | SYYKWEOXGOHBFJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | 344 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|