C16H18N2O — CID 10988828
(6E)-4-tert-butyl-6-(phenylhydrazinylidene)cyclohexa-2,4-dien-1-one (PubChem CID 10988828) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is (6E)-4-tert-butyl-6-(phenylhydrazinylidene)cyclohexa-2,4-dien-1-one.
| Compound Name | (6E)-4-tert-butyl-6-(phenylhydrazinylidene)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 10988828 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (6E)-4-tert-butyl-6-(phenylhydrazinylidene)cyclohexa-2,4-dien-1-one |
| SMILES | CC(C)(C)C1=C/C(=N\Nc2ccccc2)C(=O)C=C1 |
| InChI | InChI=1S/C16H18N2O/c1-16(2,3)12-9-10-15(19)14(11-12)18-17-13-7-5-4-6-8-13/h4-11,17H,1-3H3/b18-14+ |
| InChIKey | AFCBGSHHIUPOEP-NBVRZTHBSA-N |
| XLogP | 3.57 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|