C19H21NO3 — CID 10990571
benzyl 2-[2-(cyclohexen-1-yl)-5-methyl-1,3-oxazol-4-yl]acetate (PubChem CID 10990571) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is benzyl 2-[2-(cyclohexen-1-yl)-5-methyl-1,3-oxazol-4-yl]acetate.
| Compound Name | benzyl 2-[2-(cyclohexen-1-yl)-5-methyl-1,3-oxazol-4-yl]acetate |
|---|---|
| PubChem CID | 10990571 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | benzyl 2-[2-(cyclohexen-1-yl)-5-methyl-1,3-oxazol-4-yl]acetate |
| SMILES | Cc1oc(C2=CCCCC2)nc1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H21NO3/c1-14-17(20-19(23-14)16-10-6-3-7-11-16)12-18(21)22-13-15-8-4-2-5-9-15/h2,4-5,8-10H,3,6-7,11-13H2,1H3 |
| InChIKey | WSOONSIJQCWJNL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |