C21H28OS — CID 10991093
(1S,2S,6S,7R,11R)-11-methoxy-1,2,6-trimethyl-8-phenylsulfanyltricyclo[5.3.1.02,6]undec-8-ene (PubChem CID 10991093) has the molecular formula C21H28OS and a molecular weight of 328.52 g/mol. Its IUPAC name is (1S,2S,6S,7R,11R)-11-methoxy-1,2,6-trimethyl-8-phenylsulfanyltricyclo[5.3.1.02,6]undec-8-ene.
| Compound Name | (1S,2S,6S,7R,11R)-11-methoxy-1,2,6-trimethyl-8-phenylsulfanyltricyclo[5.3.1.02,6]undec-8-ene |
|---|---|
| PubChem CID | 10991093 |
| Molecular Formula | C21H28OS |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (1S,2S,6S,7R,11R)-11-methoxy-1,2,6-trimethyl-8-phenylsulfanyltricyclo[5.3.1.02,6]undec-8-ene |
| SMILES | CO[C@@H]1[C@@H]2C(Sc3ccccc3)=CC[C@@]1(C)[C@@]1(C)CCC[C@@]21C |
| InChI | InChI=1S/C21H28OS/c1-19-12-8-13-21(19,3)20(2)14-11-16(17(19)18(20)22-4)23-15-9-6-5-7-10-15/h5-7,9-11,17-18H,8,12-14H2,1-4H3/t17-,18+,19-,20+,21-/m0/s1 |
| InChIKey | BCNKSRGKVAHNAY-LUYSREMJSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |