C13H29FO4Si3 — CID 10991798
[3-[fluoro-bis(trimethylsilyl)silyl]oxy-5-oxopentyl] acetate (PubChem CID 10991798) has the molecular formula C13H29FO4Si3 and a molecular weight of 352.63 g/mol. Its IUPAC name is [3-[fluoro-bis(trimethylsilyl)silyl]oxy-5-oxopentyl] acetate.
| Compound Name | [3-[fluoro-bis(trimethylsilyl)silyl]oxy-5-oxopentyl] acetate |
|---|---|
| PubChem CID | 10991798 |
| Molecular Formula | C13H29FO4Si3 |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [3-[fluoro-bis(trimethylsilyl)silyl]oxy-5-oxopentyl] acetate |
| SMILES | CC(=O)OCCC(CC=O)O[Si](F)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H29FO4Si3/c1-12(16)17-11-9-13(8-10-15)18-21(14,19(2,3)4)20(5,6)7/h10,13H,8-9,11H2,1-7H3 |
| InChIKey | PYNWNBRBMFYYGD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|