C13H26O4Si — CID 75231714
ethyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate (PubChem CID 75231714) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is ethyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate.
| Compound Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate |
|---|---|
| PubChem CID | 75231714 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate |
| SMILES | CCOC(=O)CC(CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O4Si/c1-7-16-12(15)10-11(8-9-14)17-18(5,6)13(2,3)4/h9,11H,7-8,10H2,1-6H3 |
| InChIKey | ZDWICVZYCAGYEL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|