About 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate
1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate (PubChem CID 134952959) has the molecular formula C15H28O7Si
and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate |
| PubChem CID | 134952959 |
| Molecular Formula | C15H28O7Si |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate |
| SMILES | CCOC(=O)C[C@@H](CC(=O)OC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O7Si/c1-8-20-12(16)9-11(10-13(17)21-14(18)19-5)22-23(6,7)15(2,3)4/h11H,8-10H2,1-7H3/t11-/m0/s1 |
| InChIKey | PUVVJMFRCBMYBW-NSHDSACASA-N |
| XLogP | 3.03 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The IUPAC name of 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate (CID 134952959) is 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate.
What is the SMILES notation for 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The canonical SMILES for 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate is CCOC(=O)C[C@@H](CC(=O)OC(=O)OC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The InChIKey is PUVVJMFRCBMYBW-NSHDSACASA-N. The full InChI is InChI=1S/C15H28O7Si/c1-8-20-12(16)9-11(10-13(17)21-14(18)19-5)22-23(6,7)15(2,3)4/h11H,8-10H2,1-7H3/t11-/m0/s1.
What are the key properties of 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate has a molecular weight of 348.47 g/mol, XLogP of 3.03, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-methoxycarbonyl (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate is sourced from PubChem (CID 134952959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).