C20H40O4Si — CID 135012524
tert-butyl (2R,3R,4R)-2,4-dimethyl-5-oxo-3-tri(propan-2-yl)silyloxypentanoate (PubChem CID 135012524) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is tert-butyl (2R,3R,4R)-2,4-dimethyl-5-oxo-3-tri(propan-2-yl)silyloxypentanoate.
| Compound Name | tert-butyl (2R,3R,4R)-2,4-dimethyl-5-oxo-3-tri(propan-2-yl)silyloxypentanoate |
|---|---|
| PubChem CID | 135012524 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | tert-butyl (2R,3R,4R)-2,4-dimethyl-5-oxo-3-tri(propan-2-yl)silyloxypentanoate |
| SMILES | CC(C=O)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-13(2)25(14(3)4,15(5)6)24-18(16(7)12-21)17(8)19(22)23-20(9,10)11/h12-18H,1-11H3/t16?,17-,18-/m1/s1 |
| InChIKey | DBGJCKQYWBNPHA-UKKPGEIXSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|