C19H42O4Si2 — CID 10938013
methyl (2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanoate (PubChem CID 10938013) has the molecular formula C19H42O4Si2 and a molecular weight of 390.71 g/mol. Its IUPAC name is methyl (2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanoate.
| Compound Name | methyl (2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanoate |
|---|---|
| PubChem CID | 10938013 |
| Molecular Formula | C19H42O4Si2 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | methyl (2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanoate |
| SMILES | COC(=O)[C@@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H42O4Si2/c1-15(17(20)21-8)16(23-25(11,12)19(5,6)7)13-14-22-24(9,10)18(2,3)4/h15-16H,13-14H2,1-12H3/t15-,16-/m0/s1 |
| InChIKey | ZJBLXGMRFLNDLI-HOTGVXAUSA-N |
| XLogP | 5.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|