C24H54O4Si3 — CID 553829
[tert-butyl(dimethyl)silyl] 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylpentanoate (PubChem CID 553829) has the molecular formula C24H54O4Si3 and a molecular weight of 490.95 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylpentanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylpentanoate |
|---|---|
| PubChem CID | 553829 |
| Molecular Formula | C24H54O4Si3 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylpentanoate |
| SMILES | CC(CCO[Si](C)(C)C(C)(C)C)(CC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H54O4Si3/c1-21(2,3)29(11,12)26-18-17-24(10,28-31(15,16)23(7,8)9)19-20(25)27-30(13,14)22(4,5)6/h17-19H2,1-16H3 |
| InChIKey | NIHKOZDFLYTIJH-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|