C24H52O5Si3 — CID 552407
bis[tert-butyl(dimethyl)silyl] 3-[tert-butyl(dimethyl)silyl]oxy-3-methylpentanedioate (PubChem CID 552407) has the molecular formula C24H52O5Si3 and a molecular weight of 504.93 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 3-[tert-butyl(dimethyl)silyl]oxy-3-methylpentanedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] 3-[tert-butyl(dimethyl)silyl]oxy-3-methylpentanedioate |
|---|---|
| PubChem CID | 552407 |
| Molecular Formula | C24H52O5Si3 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 3-[tert-butyl(dimethyl)silyl]oxy-3-methylpentanedioate |
| SMILES | CC(CC(=O)O[Si](C)(C)C(C)(C)C)(CC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H52O5Si3/c1-21(2,3)30(11,12)27-19(25)17-24(10,29-32(15,16)23(7,8)9)18-20(26)28-31(13,14)22(4,5)6/h17-18H2,1-16H3 |
| InChIKey | JINZCJWKPQVMQZ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|