C18H40O7Si4 — CID 553132
tris(trimethylsilyl) 2-trimethylsilyloxypropane-1,2,3-tricarboxylate (PubChem CID 553132) has the molecular formula C18H40O7Si4 and a molecular weight of 480.86 g/mol. Its IUPAC name is tris(trimethylsilyl) 2-trimethylsilyloxypropane-1,2,3-tricarboxylate.
| Compound Name | tris(trimethylsilyl) 2-trimethylsilyloxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 553132 |
| Molecular Formula | C18H40O7Si4 |
| Molecular Weight | 480.86 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | tris(trimethylsilyl) 2-trimethylsilyloxypropane-1,2,3-tricarboxylate |
| SMILES | C[Si](C)(C)OC(=O)CC(CC(=O)O[Si](C)(C)C)(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C18H40O7Si4/c1-26(2,3)22-15(19)13-18(25-29(10,11)12,17(21)24-28(7,8)9)14-16(20)23-27(4,5)6/h13-14H2,1-12H3 |
| InChIKey | VFGAVMGYDWDESE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.86 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|