C15H32O7Si3 — CID 91696760
tris(trimethylsilyl) 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 91696760) has the molecular formula C15H32O7Si3 and a molecular weight of 408.67 g/mol. Its IUPAC name is tris(trimethylsilyl) 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | tris(trimethylsilyl) 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 91696760 |
| Molecular Formula | C15H32O7Si3 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | tris(trimethylsilyl) 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | C[Si](C)(C)OC(=O)CC(O)(CC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H32O7Si3/c1-23(2,3)20-12(16)10-15(19,14(18)22-25(7,8)9)11-13(17)21-24(4,5)6/h19H,10-11H2,1-9H3 |
| InChIKey | HNRUOTSRMGCNPS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|