C31H66O7Si4 — CID 6430569
tris[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxybutane-1,2,3-tricarboxylate (PubChem CID 6430569) has the molecular formula C31H66O7Si4 and a molecular weight of 663.21 g/mol. Its IUPAC name is tris[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxybutane-1,2,3-tricarboxylate.
| Compound Name | tris[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxybutane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 6430569 |
| Molecular Formula | C31H66O7Si4 |
| Molecular Weight | 663.21 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | tris[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxybutane-1,2,3-tricarboxylate |
| SMILES | CC(C(=O)O[Si](C)(C)C(C)(C)C)C(CC(=O)O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H66O7Si4/c1-23(25(33)36-40(16,17)28(5,6)7)31(38-42(20,21)30(11,12)13,26(34)37-41(18,19)29(8,9)10)22-24(32)35-39(14,15)27(2,3)4/h23H,22H2,1-21H3 |
| InChIKey | RGQSPHREDDNOIS-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.21 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|