C21H50O7Si5 — CID 523352
bis(trimethylsilyl) (2R,4S)-2,4-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)pentanedioate (PubChem CID 523352) has the molecular formula C21H50O7Si5 and a molecular weight of 555.05 g/mol. Its IUPAC name is bis(trimethylsilyl) (2R,4S)-2,4-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)pentanedioate.
| Compound Name | bis(trimethylsilyl) (2R,4S)-2,4-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)pentanedioate |
|---|---|
| PubChem CID | 523352 |
| Molecular Formula | C21H50O7Si5 |
| Molecular Weight | 555.05 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | bis(trimethylsilyl) (2R,4S)-2,4-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)pentanedioate |
| SMILES | C[Si](C)(C)OC[C@@](C[C@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C)(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C21H50O7Si5/c1-29(2,3)24-17-21(28-33(13,14)15,20(23)27-32(10,11)12)16-18(25-30(4,5)6)19(22)26-31(7,8)9/h18H,16-17H2,1-15H3/t18-,21+/m0/s1 |
| InChIKey | WNEDAUVACAQDIF-GHTZIAJQSA-N |
| XLogP | 5.79 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.05 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|