C23H50O5Si3 — CID 634802
bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxypentanedioate (PubChem CID 634802) has the molecular formula C23H50O5Si3 and a molecular weight of 490.91 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxypentanedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxypentanedioate |
|---|---|
| PubChem CID | 634802 |
| Molecular Formula | C23H50O5Si3 |
| Molecular Weight | 490.91 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxypentanedioate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)CCC(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H50O5Si3/c1-21(2,3)29(10,11)26-18(20(25)28-31(14,15)23(7,8)9)16-17-19(24)27-30(12,13)22(4,5)6/h18H,16-17H2,1-15H3 |
| InChIKey | HZEWZIFIXNHNJX-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.91 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|