C18H42O7Si4 — CID 523343
bis(trimethylsilyl) (2S,3S,4R)-2-methoxy-3,4-bis(trimethylsilyloxy)pentanedioate (PubChem CID 523343) has the molecular formula C18H42O7Si4 and a molecular weight of 482.87 g/mol. Its IUPAC name is bis(trimethylsilyl) (2S,3S,4R)-2-methoxy-3,4-bis(trimethylsilyloxy)pentanedioate.
| Compound Name | bis(trimethylsilyl) (2S,3S,4R)-2-methoxy-3,4-bis(trimethylsilyloxy)pentanedioate |
|---|---|
| PubChem CID | 523343 |
| Molecular Formula | C18H42O7Si4 |
| Molecular Weight | 482.87 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | bis(trimethylsilyl) (2S,3S,4R)-2-methoxy-3,4-bis(trimethylsilyloxy)pentanedioate |
| SMILES | CO[C@H](C(=O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C18H42O7Si4/c1-21-15(17(19)24-28(8,9)10)14(22-26(2,3)4)16(23-27(5,6)7)18(20)25-29(11,12)13/h14-16H,1-13H3/t14-,15-,16+/m0/s1 |
| InChIKey | XHKNNVYRCFXZBF-HRCADAONSA-N |
| XLogP | 4.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|