C17H36O7Si3 — CID 553684
2-O-ethyl 1-O,3-O-bis(trimethylsilyl) 2-trimethylsilyloxypropane-1,2,3-tricarboxylate (PubChem CID 553684) has the molecular formula C17H36O7Si3 and a molecular weight of 436.73 g/mol. Its IUPAC name is 2-O-ethyl 1-O,3-O-bis(trimethylsilyl) 2-trimethylsilyloxypropane-1,2,3-tricarboxylate.
| Compound Name | 2-O-ethyl 1-O,3-O-bis(trimethylsilyl) 2-trimethylsilyloxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 553684 |
| Molecular Formula | C17H36O7Si3 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-O-ethyl 1-O,3-O-bis(trimethylsilyl) 2-trimethylsilyloxypropane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)C(CC(=O)O[Si](C)(C)C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H36O7Si3/c1-11-21-16(20)17(24-27(8,9)10,12-14(18)22-25(2,3)4)13-15(19)23-26(5,6)7/h11-13H2,1-10H3 |
| InChIKey | VMMOSKOGLTUYNK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|