C12H22O6Si2 — CID 553088
bis(trimethylsilyl) 5-oxooxolane-2,3-dicarboxylate (PubChem CID 553088) has the molecular formula C12H22O6Si2 and a molecular weight of 318.47 g/mol. Its IUPAC name is bis(trimethylsilyl) 5-oxooxolane-2,3-dicarboxylate.
| Compound Name | bis(trimethylsilyl) 5-oxooxolane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 553088 |
| Molecular Formula | C12H22O6Si2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | bis(trimethylsilyl) 5-oxooxolane-2,3-dicarboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1CC(=O)OC1C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C12H22O6Si2/c1-19(2,3)17-11(14)8-7-9(13)16-10(8)12(15)18-20(4,5)6/h8,10H,7H2,1-6H3 |
| InChIKey | IBEFDHMMOJYHKQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|