C9H15NO3Si — CID 131052928
trimethylsilyl (2R)-4-methylidene-5-oxopyrrolidine-2-carboxylate (PubChem CID 131052928) has the molecular formula C9H15NO3Si and a molecular weight of 213.31 g/mol. Its IUPAC name is trimethylsilyl (2R)-4-methylidene-5-oxopyrrolidine-2-carboxylate.
| Compound Name | trimethylsilyl (2R)-4-methylidene-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 131052928 |
| Molecular Formula | C9H15NO3Si |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | trimethylsilyl (2R)-4-methylidene-5-oxopyrrolidine-2-carboxylate |
| SMILES | C=C1C[C@H](C(=O)O[Si](C)(C)C)NC1=O |
| InChI | InChI=1S/C9H15NO3Si/c1-6-5-7(10-8(6)11)9(12)13-14(2,3)4/h7H,1,5H2,2-4H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | AMKNNZQMGRLDIP-SSDOTTSWSA-N |
| XLogP | 0.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|