C19H42O7Si4 — CID 530815
tris(trimethylsilyl) 1-trimethylsilyloxybutane-1,2,3-tricarboxylate (PubChem CID 530815) has the molecular formula C19H42O7Si4 and a molecular weight of 494.88 g/mol. Its IUPAC name is tris(trimethylsilyl) 1-trimethylsilyloxybutane-1,2,3-tricarboxylate.
| Compound Name | tris(trimethylsilyl) 1-trimethylsilyloxybutane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 530815 |
| Molecular Formula | C19H42O7Si4 |
| Molecular Weight | 494.88 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | tris(trimethylsilyl) 1-trimethylsilyloxybutane-1,2,3-tricarboxylate |
| SMILES | CC(C(=O)O[Si](C)(C)C)C(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C19H42O7Si4/c1-14(17(20)24-28(5,6)7)15(18(21)25-29(8,9)10)16(23-27(2,3)4)19(22)26-30(11,12)13/h14-16H,1-13H3 |
| InChIKey | PJGUFNNMVFUWFQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|