C24H60O7Si6 — CID 523321
trimethylsilyl 2,3,4,5-tetrakis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)pentanoate (PubChem CID 523321) has the molecular formula C24H60O7Si6 and a molecular weight of 629.25 g/mol. Its IUPAC name is trimethylsilyl 2,3,4,5-tetrakis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)pentanoate.
| Compound Name | trimethylsilyl 2,3,4,5-tetrakis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)pentanoate |
|---|---|
| PubChem CID | 523321 |
| Molecular Formula | C24H60O7Si6 |
| Molecular Weight | 629.25 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | trimethylsilyl 2,3,4,5-tetrakis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)pentanoate |
| SMILES | C[Si](C)(C)OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C24H60O7Si6/c1-32(2,3)26-19-21(28-34(7,8)9)22(29-35(10,11)12)24(31-37(16,17)18,20-27-33(4,5)6)23(25)30-36(13,14)15/h21-22H,19-20H2,1-18H3 |
| InChIKey | KGHUMIAEJNYKKE-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.25 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|